C7H14N4O4S2 — CID 103680432
N-[2-(ethylsulfamoyl)ethyl]-1H-imidazole-5-sulfonamide (PubChem CID 103680432) has the molecular formula C7H14N4O4S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is N-[2-(ethylsulfamoyl)ethyl]-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-(ethylsulfamoyl)ethyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 103680432 |
| Molecular Formula | C7H14N4O4S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | N-[2-(ethylsulfamoyl)ethyl]-1H-imidazole-5-sulfonamide |
| SMILES | CCNS(=O)(=O)CCNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C7H14N4O4S2/c1-2-10-16(12,13)4-3-11-17(14,15)7-5-8-6-9-7/h5-6,10-11H,2-4H2,1H3,(H,8,9) |
| InChIKey | JTMBKXYDSXKSGN-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |