C10H19N3O2S2 — CID 113414965
N-(6-methylsulfanylhexyl)-1H-imidazole-5-sulfonamide (PubChem CID 113414965) has the molecular formula C10H19N3O2S2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-(6-methylsulfanylhexyl)-1H-imidazole-5-sulfonamide.
| Compound Name | N-(6-methylsulfanylhexyl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 113414965 |
| Molecular Formula | C10H19N3O2S2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | N-(6-methylsulfanylhexyl)-1H-imidazole-5-sulfonamide |
| SMILES | CSCCCCCCNS(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C10H19N3O2S2/c1-16-7-5-3-2-4-6-13-17(14,15)10-8-11-9-12-10/h8-9,13H,2-7H2,1H3,(H,11,12) |
| InChIKey | YPSUIQSBKOXEQK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|