C10H17N3O4S — CID 81005469
tert-butyl (2R)-2-(1H-imidazol-5-ylsulfonylamino)propanoate (PubChem CID 81005469) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is tert-butyl (2R)-2-(1H-imidazol-5-ylsulfonylamino)propanoate.
| Compound Name | tert-butyl (2R)-2-(1H-imidazol-5-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 81005469 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | tert-butyl (2R)-2-(1H-imidazol-5-ylsulfonylamino)propanoate |
| SMILES | C[C@@H](NS(=O)(=O)c1cnc[nH]1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H17N3O4S/c1-7(9(14)17-10(2,3)4)13-18(15,16)8-5-11-6-12-8/h5-7,13H,1-4H3,(H,11,12)/t7-/m1/s1 |
| InChIKey | QSGHOZMZNGMDPV-SSDOTTSWSA-N |
| XLogP | 0.42 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |