C12H23N3O2S — CID 65042707
2-ethyl-N-(3-ethylpentan-3-yl)-1H-imidazole-5-sulfonamide (PubChem CID 65042707) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-ethyl-N-(3-ethylpentan-3-yl)-1H-imidazole-5-sulfonamide.
| Compound Name | 2-ethyl-N-(3-ethylpentan-3-yl)-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 65042707 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 2-ethyl-N-(3-ethylpentan-3-yl)-1H-imidazole-5-sulfonamide |
| SMILES | CCc1ncc(S(=O)(=O)NC(CC)(CC)CC)[nH]1 |
| InChI | InChI=1S/C12H23N3O2S/c1-5-10-13-9-11(14-10)18(16,17)15-12(6-2,7-3)8-4/h9,15H,5-8H2,1-4H3,(H,13,14) |
| InChIKey | GIFMTLPLUBVPSI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |