C8H13N3O5S — CID 80749768
(2R)-2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-3-hydroxypropanoic acid (PubChem CID 80749768) has the molecular formula C8H13N3O5S and a molecular weight of 263.27 g/mol. Its IUPAC name is (2R)-2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-3-hydroxypropanoic acid.
| Compound Name | (2R)-2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 80749768 |
| Molecular Formula | C8H13N3O5S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | (2R)-2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]-3-hydroxypropanoic acid |
| SMILES | CCc1ncc(S(=O)(=O)N[C@H](CO)C(=O)O)[nH]1 |
| InChI | InChI=1S/C8H13N3O5S/c1-2-6-9-3-7(10-6)17(15,16)11-5(4-12)8(13)14/h3,5,11-12H,2,4H2,1H3,(H,9,10)(H,13,14)/t5-/m1/s1 |
| InChIKey | BPAVOMACSJFVCF-RXMQYKEDSA-N |
| XLogP | -1.30 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |