C11H17N3O2S — CID 106229017
2-ethyl-N-hex-1-yn-3-yl-1H-imidazole-5-sulfonamide (PubChem CID 106229017) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-ethyl-N-hex-1-yn-3-yl-1H-imidazole-5-sulfonamide.
| Compound Name | 2-ethyl-N-hex-1-yn-3-yl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 106229017 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-ethyl-N-hex-1-yn-3-yl-1H-imidazole-5-sulfonamide |
| SMILES | C#CC(CCC)NS(=O)(=O)c1cnc(CC)[nH]1 |
| InChI | InChI=1S/C11H17N3O2S/c1-4-7-9(5-2)14-17(15,16)11-8-12-10(6-3)13-11/h2,8-9,14H,4,6-7H2,1,3H3,(H,12,13) |
| InChIKey | QIJCHHUILIZUQB-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|