C8H19N3O3S — CID 106153953
3-N-(cyclopropylsulfamoyl)-4-methoxybutane-1,3-diamine (PubChem CID 106153953) has the molecular formula C8H19N3O3S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-N-(cyclopropylsulfamoyl)-4-methoxybutane-1,3-diamine.
| Compound Name | 3-N-(cyclopropylsulfamoyl)-4-methoxybutane-1,3-diamine |
|---|---|
| PubChem CID | 106153953 |
| Molecular Formula | C8H19N3O3S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-N-(cyclopropylsulfamoyl)-4-methoxybutane-1,3-diamine |
| SMILES | COCC(CCN)NS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H19N3O3S/c1-14-6-8(4-5-9)11-15(12,13)10-7-2-3-7/h7-8,10-11H,2-6,9H2,1H3 |
| InChIKey | ARAVRIVCQGEFNG-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |