C8H19N3O2S — CID 114812950
4-N-(cyclopropylsulfamoyl)pentane-2,4-diamine (PubChem CID 114812950) has the molecular formula C8H19N3O2S and a molecular weight of 221.33 g/mol. Its IUPAC name is 4-N-(cyclopropylsulfamoyl)pentane-2,4-diamine.
| Compound Name | 4-N-(cyclopropylsulfamoyl)pentane-2,4-diamine |
|---|---|
| PubChem CID | 114812950 |
| Molecular Formula | C8H19N3O2S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 4-N-(cyclopropylsulfamoyl)pentane-2,4-diamine |
| SMILES | CC(N)CC(C)NS(=O)(=O)NC1CC1 |
| InChI | InChI=1S/C8H19N3O2S/c1-6(9)5-7(2)10-14(12,13)11-8-3-4-8/h6-8,10-11H,3-5,9H2,1-2H3 |
| InChIKey | FMKFCBSYJUJTLB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |