C8H15N3O5S — CID 104935540
(2R)-5-amino-2-(cyclopropylsulfamoylamino)-5-oxopentanoic acid (PubChem CID 104935540) has the molecular formula C8H15N3O5S and a molecular weight of 265.29 g/mol. Its IUPAC name is (2R)-5-amino-2-(cyclopropylsulfamoylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(cyclopropylsulfamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 104935540 |
| Molecular Formula | C8H15N3O5S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | (2R)-5-amino-2-(cyclopropylsulfamoylamino)-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](NS(=O)(=O)NC1CC1)C(=O)O |
| InChI | InChI=1S/C8H15N3O5S/c9-7(12)4-3-6(8(13)14)11-17(15,16)10-5-1-2-5/h5-6,10-11H,1-4H2,(H2,9,12)(H,13,14)/t6-/m1/s1 |
| InChIKey | CQQOAUZPYNKEGR-ZCFIWIBFSA-N |
| XLogP | -1.71 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |