C9H24ClN3O2S — CID 120875561
2-N-(propan-2-ylsulfamoyl)hexane-1,2-diamine;hydrochloride (PubChem CID 120875561) has the molecular formula C9H24ClN3O2S and a molecular weight of 273.83 g/mol. Its IUPAC name is 2-N-(propan-2-ylsulfamoyl)hexane-1,2-diamine;hydrochloride.
| Compound Name | 2-N-(propan-2-ylsulfamoyl)hexane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 120875561 |
| Molecular Formula | C9H24ClN3O2S |
| Molecular Weight | 273.83 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-N-(propan-2-ylsulfamoyl)hexane-1,2-diamine;hydrochloride |
| SMILES | CCCCC(CN)NS(=O)(=O)NC(C)C.Cl |
| InChI | InChI=1S/C9H23N3O2S.ClH/c1-4-5-6-9(7-10)12-15(13,14)11-8(2)3;/h8-9,11-12H,4-7,10H2,1-3H3;1H |
| InChIKey | KUMLWDIQLLTJCH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.83 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |