C10H22N2O5S — CID 115754514
methyl 3-[2-hydroxypentylsulfamoyl(methyl)amino]propanoate (PubChem CID 115754514) has the molecular formula C10H22N2O5S and a molecular weight of 282.36 g/mol. Its IUPAC name is methyl 3-[2-hydroxypentylsulfamoyl(methyl)amino]propanoate.
| Compound Name | methyl 3-[2-hydroxypentylsulfamoyl(methyl)amino]propanoate |
|---|---|
| PubChem CID | 115754514 |
| Molecular Formula | C10H22N2O5S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | methyl 3-[2-hydroxypentylsulfamoyl(methyl)amino]propanoate |
| SMILES | CCCC(O)CNS(=O)(=O)N(C)CCC(=O)OC |
| InChI | InChI=1S/C10H22N2O5S/c1-4-5-9(13)8-11-18(15,16)12(2)7-6-10(14)17-3/h9,11,13H,4-8H2,1-3H3 |
| InChIKey | QKMYEBQPOBLUDX-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |