C11H23N3O5S — CID 106610356
propan-2-yl N-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]carbamate (PubChem CID 106610356) has the molecular formula C11H23N3O5S and a molecular weight of 309.39 g/mol. Its IUPAC name is propan-2-yl N-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]carbamate.
| Compound Name | propan-2-yl N-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 106610356 |
| Molecular Formula | C11H23N3O5S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | propan-2-yl N-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)sulfamoyl]carbamate |
| SMILES | CC(C)OC(=O)NS(=O)(=O)N(CCO)CC1CCCN1 |
| InChI | InChI=1S/C11H23N3O5S/c1-9(2)19-11(16)13-20(17,18)14(6-7-15)8-10-4-3-5-12-10/h9-10,12,15H,3-8H2,1-2H3,(H,13,16) |
| InChIKey | JQXWIKNLZDUJNI-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |