C13H27N3O3 — CID 106617890
2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-N-(1-methoxypropan-2-yl)acetamide (PubChem CID 106617890) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-N-(1-methoxypropan-2-yl)acetamide.
| Compound Name | 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-N-(1-methoxypropan-2-yl)acetamide |
|---|---|
| PubChem CID | 106617890 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]-N-(1-methoxypropan-2-yl)acetamide |
| SMILES | COCC(C)NC(=O)CN(CCO)CC1CCCN1 |
| InChI | InChI=1S/C13H27N3O3/c1-11(10-19-2)15-13(18)9-16(6-7-17)8-12-4-3-5-14-12/h11-12,14,17H,3-10H2,1-2H3,(H,15,18) |
| InChIKey | OYLSRLGWMSNUHB-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |