C11H22N2O3 — CID 106617961
ethyl 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]acetate (PubChem CID 106617961) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is ethyl 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]acetate.
| Compound Name | ethyl 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 106617961 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | ethyl 2-[2-hydroxyethyl(pyrrolidin-2-ylmethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCO)CC1CCCN1 |
| InChI | InChI=1S/C11H22N2O3/c1-2-16-11(15)9-13(6-7-14)8-10-4-3-5-12-10/h10,12,14H,2-9H2,1H3 |
| InChIKey | BYDDAVJTJSTGAQ-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |