C9H18N4O2 — CID 102819499
2-[(2-amino-2-oxoethyl)-[[(2R)-pyrrolidin-2-yl]methyl]amino]acetamide (PubChem CID 102819499) has the molecular formula C9H18N4O2 and a molecular weight of 214.27 g/mol. Its IUPAC name is 2-[(2-amino-2-oxoethyl)-[[(2R)-pyrrolidin-2-yl]methyl]amino]acetamide.
| Compound Name | 2-[(2-amino-2-oxoethyl)-[[(2R)-pyrrolidin-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 102819499 |
| Molecular Formula | C9H18N4O2 |
| Molecular Weight | 214.27 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 2-[(2-amino-2-oxoethyl)-[[(2R)-pyrrolidin-2-yl]methyl]amino]acetamide |
| SMILES | NC(=O)CN(CC(N)=O)C[C@H]1CCCN1 |
| InChI | InChI=1S/C9H18N4O2/c10-8(14)5-13(6-9(11)15)4-7-2-1-3-12-7/h7,12H,1-6H2,(H2,10,14)(H2,11,15)/t7-/m1/s1 |
| InChIKey | BHQWYCBUUKWWSU-SSDOTTSWSA-N |
| XLogP | -1.99 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.27 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |