C11H23N3O — CID 106614462
2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]propanamide (PubChem CID 106614462) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]propanamide.
| Compound Name | 2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 106614462 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 2-[propan-2-yl(pyrrolidin-2-ylmethyl)amino]propanamide |
| SMILES | CC(C)N(CC1CCCN1)C(C)C(N)=O |
| InChI | InChI=1S/C11H23N3O/c1-8(2)14(9(3)11(12)15)7-10-5-4-6-13-10/h8-10,13H,4-7H2,1-3H3,(H2,12,15) |
| InChIKey | MOEOMKPXMSKPFL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |