C12H23N3O — CID 106616433
3-[cyclopropylmethyl(pyrrolidin-2-ylmethyl)amino]propanamide (PubChem CID 106616433) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 3-[cyclopropylmethyl(pyrrolidin-2-ylmethyl)amino]propanamide.
| Compound Name | 3-[cyclopropylmethyl(pyrrolidin-2-ylmethyl)amino]propanamide |
|---|---|
| PubChem CID | 106616433 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 3-[cyclopropylmethyl(pyrrolidin-2-ylmethyl)amino]propanamide |
| SMILES | NC(=O)CCN(CC1CC1)CC1CCCN1 |
| InChI | InChI=1S/C12H23N3O/c13-12(16)5-7-15(8-10-3-4-10)9-11-2-1-6-14-11/h10-11,14H,1-9H2,(H2,13,16) |
| InChIKey | HGEHCRPGIMUWAA-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |