C10H20N2O3 — CID 106297630
propan-2-yl N-[4-(aminomethyl)oxan-4-yl]carbamate (PubChem CID 106297630) has the molecular formula C10H20N2O3 and a molecular weight of 216.28 g/mol. Its IUPAC name is propan-2-yl N-[4-(aminomethyl)oxan-4-yl]carbamate.
| Compound Name | propan-2-yl N-[4-(aminomethyl)oxan-4-yl]carbamate |
|---|---|
| PubChem CID | 106297630 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | propan-2-yl N-[4-(aminomethyl)oxan-4-yl]carbamate |
| SMILES | CC(C)OC(=O)NC1(CN)CCOCC1 |
| InChI | InChI=1S/C10H20N2O3/c1-8(2)15-9(13)12-10(7-11)3-5-14-6-4-10/h8H,3-7,11H2,1-2H3,(H,12,13) |
| InChIKey | GGHLQMWYNQJILK-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |