C12H17ClN2O4S — CID 105060300
ethyl N-[(1-chloro-2-phenylpropan-2-yl)sulfamoyl]carbamate (PubChem CID 105060300) has the molecular formula C12H17ClN2O4S and a molecular weight of 320.80 g/mol. Its IUPAC name is ethyl N-[(1-chloro-2-phenylpropan-2-yl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(1-chloro-2-phenylpropan-2-yl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 105060300 |
| Molecular Formula | C12H17ClN2O4S |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | ethyl N-[(1-chloro-2-phenylpropan-2-yl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NC(C)(CCl)c1ccccc1 |
| InChI | InChI=1S/C12H17ClN2O4S/c1-3-19-11(16)14-20(17,18)15-12(2,9-13)10-7-5-4-6-8-10/h4-8,15H,3,9H2,1-2H3,(H,14,16) |
| InChIKey | JNJYGZRTDHYKAH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|