C12H16ClNO2S — CID 105060342
N-(1-chloro-2-phenylpropan-2-yl)cyclopropanesulfonamide (PubChem CID 105060342) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is N-(1-chloro-2-phenylpropan-2-yl)cyclopropanesulfonamide.
| Compound Name | N-(1-chloro-2-phenylpropan-2-yl)cyclopropanesulfonamide |
|---|---|
| PubChem CID | 105060342 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | N-(1-chloro-2-phenylpropan-2-yl)cyclopropanesulfonamide |
| SMILES | CC(CCl)(NS(=O)(=O)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C12H16ClNO2S/c1-12(9-13,10-5-3-2-4-6-10)14-17(15,16)11-7-8-11/h2-6,11,14H,7-9H2,1H3 |
| InChIKey | RHFGQNCCJXSBBV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|