C21H36N4O4S — CID 162404971
tert-butyl 2-[[2-(diethylaminodiazenyl)-4-methylphenyl]sulfonylamino]-4-methylpentanoate (PubChem CID 162404971) has the molecular formula C21H36N4O4S and a molecular weight of 440.61 g/mol. Its IUPAC name is tert-butyl 2-[[2-(diethylaminodiazenyl)-4-methylphenyl]sulfonylamino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[2-(diethylaminodiazenyl)-4-methylphenyl]sulfonylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 162404971 |
| Molecular Formula | C21H36N4O4S |
| Molecular Weight | 440.61 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | tert-butyl 2-[[2-(diethylaminodiazenyl)-4-methylphenyl]sulfonylamino]-4-methylpentanoate |
| SMILES | CCN(CC)/N=N/c1cc(C)ccc1S(=O)(=O)NC(CC(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H36N4O4S/c1-9-25(10-2)24-22-17-14-16(5)11-12-19(17)30(27,28)23-18(13-15(3)4)20(26)29-21(6,7)8/h11-12,14-15,18,23H,9-10,13H2,1-8H3/b24-22+ |
| InChIKey | NGZFSHKHHMBHFZ-ZNTNEXAZSA-N |
| XLogP | 4.37 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.61 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|