C21H45NO4 — CID 169300394
N-[2-[2-[4-[2-(4,4-dimethylpentoxy)ethoxy]butoxy]ethoxy]ethyl]-2-methylpropan-2-amine (PubChem CID 169300394) has the molecular formula C21H45NO4 and a molecular weight of 375.59 g/mol. Its IUPAC name is N-[2-[2-[4-[2-(4,4-dimethylpentoxy)ethoxy]butoxy]ethoxy]ethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-[2-[4-[2-(4,4-dimethylpentoxy)ethoxy]butoxy]ethoxy]ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 169300394 |
| Molecular Formula | C21H45NO4 |
| Molecular Weight | 375.59 g/mol |
| Exact Mass | 375.33 |
| IUPAC Name | N-[2-[2-[4-[2-(4,4-dimethylpentoxy)ethoxy]butoxy]ethoxy]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)CCCOCCOCCCCOCCOCCNC(C)(C)C |
| InChI | InChI=1S/C21H45NO4/c1-20(2,3)10-9-14-25-17-16-23-12-7-8-13-24-18-19-26-15-11-22-21(4,5)6/h22H,7-19H2,1-6H3 |
| InChIKey | LINVRQYVMVVIPD-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|