C9H18ClNO2 — CID 106306571
N-[3-(2-chloroethoxy)propyl]butanamide (PubChem CID 106306571) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is N-[3-(2-chloroethoxy)propyl]butanamide.
| Compound Name | N-[3-(2-chloroethoxy)propyl]butanamide |
|---|---|
| PubChem CID | 106306571 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | N-[3-(2-chloroethoxy)propyl]butanamide |
| SMILES | CCCC(=O)NCCCOCCCl |
| InChI | InChI=1S/C9H18ClNO2/c1-2-4-9(12)11-6-3-7-13-8-5-10/h2-8H2,1H3,(H,11,12) |
| InChIKey | UKOJVEFTMQQQAW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|