C9H18CoNO3- — CID 168904069
1-[2-(2-aminoethoxy)ethoxy]-3-methylbutan-2-one;cobalt (PubChem CID 168904069) has the molecular formula C9H18CoNO3- and a molecular weight of 247.18 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)ethoxy]-3-methylbutan-2-one;cobalt.
| Compound Name | 1-[2-(2-aminoethoxy)ethoxy]-3-methylbutan-2-one;cobalt |
|---|---|
| PubChem CID | 168904069 |
| Molecular Formula | C9H18CoNO3- |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 1-[2-(2-aminoethoxy)ethoxy]-3-methylbutan-2-one;cobalt |
| SMILES | C[C-](C)C(=O)COCCOCCN.[Co] |
| InChI | InChI=1S/C9H18NO3.Co/c1-8(2)9(11)7-13-6-5-12-4-3-10;/h3-7,10H2,1-2H3;/q-1; |
| InChIKey | DXEVIKYHAMOIFR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|