C17H37Cl2N3O9 — CID 173310243
N-(2-aminoethyl)-2-(methylamino)acetamide;3-[2-[1-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid;dihydrochloride (PubChem CID 173310243) has the molecular formula C17H37Cl2N3O9 and a molecular weight of 498.40 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(methylamino)acetamide;3-[2-[1-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid;dihydrochloride.
| Compound Name | N-(2-aminoethyl)-2-(methylamino)acetamide;3-[2-[1-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 173310243 |
| Molecular Formula | C17H37Cl2N3O9 |
| Molecular Weight | 498.40 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | N-(2-aminoethyl)-2-(methylamino)acetamide;3-[2-[1-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]propanoic acid;dihydrochloride |
| SMILES | CC(OCCOCCC(=O)O)OCCOCCC(=O)O.CNCC(=O)NCCN.Cl.Cl |
| InChI | InChI=1S/C12H22O8.C5H13N3O.2ClH/c1-10(19-8-6-17-4-2-11(13)14)20-9-7-18-5-3-12(15)16;1-7-4-5(9)8-3-2-6;;/h10H,2-9H2,1H3,(H,13,14)(H,15,16);7H,2-4,6H2,1H3,(H,8,9);2*1H |
| InChIKey | XGLCAEUXWPVFHK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 178.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.40 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|