C12H28N4O3 — CID 144897586
N-(2-aminoethyl)-3-[2-[2-[2-(methylamino)ethylamino]ethoxy]ethoxy]propanamide (PubChem CID 144897586) has the molecular formula C12H28N4O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-(2-aminoethyl)-3-[2-[2-[2-(methylamino)ethylamino]ethoxy]ethoxy]propanamide.
| Compound Name | N-(2-aminoethyl)-3-[2-[2-[2-(methylamino)ethylamino]ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 144897586 |
| Molecular Formula | C12H28N4O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N-(2-aminoethyl)-3-[2-[2-[2-(methylamino)ethylamino]ethoxy]ethoxy]propanamide |
| SMILES | CNCCNCCOCCOCCC(=O)NCCN |
| InChI | InChI=1S/C12H28N4O3/c1-14-5-6-15-7-9-19-11-10-18-8-2-12(17)16-4-3-13/h14-15H,2-11,13H2,1H3,(H,16,17) |
| InChIKey | BLVFSZWNCPPEFV-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|