C14H32IN5O — CID 110927369
2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110927369) has the molecular formula C14H32IN5O and a molecular weight of 413.35 g/mol. Its IUPAC name is 2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110927369 |
| Molecular Formula | C14H32IN5O |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[3-(4-ethylpiperazin-1-yl)-2-methylpropyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | CCN1CCN(CC(C)C/N=C(\N)NCCOC)CC1.I |
| InChI | InChI=1S/C14H31N5O.HI/c1-4-18-6-8-19(9-7-18)12-13(2)11-17-14(15)16-5-10-20-3;/h13H,4-12H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | DPNVISUVCDBKLJ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|