C10H22IN3O2 — CID 110930532
methyl 3-[bis(ethylamino)methylideneamino]-2-methylpropanoate;hydroiodide (PubChem CID 110930532) has the molecular formula C10H22IN3O2 and a molecular weight of 343.21 g/mol. Its IUPAC name is methyl 3-[bis(ethylamino)methylideneamino]-2-methylpropanoate;hydroiodide.
| Compound Name | methyl 3-[bis(ethylamino)methylideneamino]-2-methylpropanoate;hydroiodide |
|---|---|
| PubChem CID | 110930532 |
| Molecular Formula | C10H22IN3O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | methyl 3-[bis(ethylamino)methylideneamino]-2-methylpropanoate;hydroiodide |
| SMILES | CCNC(=NCC(C)C(=O)OC)NCC.I |
| InChI | InChI=1S/C10H21N3O2.HI/c1-5-11-10(12-6-2)13-7-8(3)9(14)15-4;/h8H,5-7H2,1-4H3,(H2,11,12,13);1H |
| InChIKey | PUNGWXJHJFIQSO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|