C11H25IN4O3 — CID 111037013
2-[[amino-(3-ethoxypropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide (PubChem CID 111037013) has the molecular formula C11H25IN4O3 and a molecular weight of 388.25 g/mol. Its IUPAC name is 2-[[amino-(3-ethoxypropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide.
| Compound Name | 2-[[amino-(3-ethoxypropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111037013 |
| Molecular Formula | C11H25IN4O3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[[amino-(3-ethoxypropylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide;hydroiodide |
| SMILES | CCOCCCN/C(N)=N/CC(=O)NCCOC.I |
| InChI | InChI=1S/C11H24N4O3.HI/c1-3-18-7-4-5-14-11(12)15-9-10(16)13-6-8-17-2;/h3-9H2,1-2H3,(H,13,16)(H3,12,14,15);1H |
| InChIKey | PJBIXDQMWBQEMZ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|