C19H42N6 — CID 166723390
N'-[3-(diethylamino)propyl]-N-[N'-[3-(diethylamino)propyl]carbamimidoyl]-2-methylpropanimidamide (PubChem CID 166723390) has the molecular formula C19H42N6 and a molecular weight of 354.59 g/mol. Its IUPAC name is N'-[3-(diethylamino)propyl]-N-[N'-[3-(diethylamino)propyl]carbamimidoyl]-2-methylpropanimidamide.
| Compound Name | N'-[3-(diethylamino)propyl]-N-[N'-[3-(diethylamino)propyl]carbamimidoyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 166723390 |
| Molecular Formula | C19H42N6 |
| Molecular Weight | 354.59 g/mol |
| Exact Mass | 354.35 |
| IUPAC Name | N'-[3-(diethylamino)propyl]-N-[N'-[3-(diethylamino)propyl]carbamimidoyl]-2-methylpropanimidamide |
| SMILES | CCN(CC)CCC/N=C(\N)N/C(=N/CCCN(CC)CC)C(C)C |
| InChI | InChI=1S/C19H42N6/c1-7-24(8-2)15-11-13-21-18(17(5)6)23-19(20)22-14-12-16-25(9-3)10-4/h17H,7-16H2,1-6H3,(H3,20,21,22,23) |
| InChIKey | IWCNNJSNZFJSGY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.59 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|