C21H28N4O2S — CID 110948202
2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-(1-phenylethyl)guanidine (PubChem CID 110948202) has the molecular formula C21H28N4O2S and a molecular weight of 400.55 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-(1-phenylethyl)guanidine.
| Compound Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-(1-phenylethyl)guanidine |
|---|---|
| PubChem CID | 110948202 |
| Molecular Formula | C21H28N4O2S |
| Molecular Weight | 400.55 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-(1-phenylethyl)guanidine |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCc2ccccc21)NC(C)c1ccccc1 |
| InChI | InChI=1S/C21H28N4O2S/c1-3-22-21(24-17(2)18-9-5-4-6-10-18)23-14-16-28(26,27)25-15-13-19-11-7-8-12-20(19)25/h4-12,17H,3,13-16H2,1-2H3,(H2,22,23,24) |
| InChIKey | GCUWYRZNBIQMDY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|