C19H28IN5O2S2 — CID 111932670
2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111932670) has the molecular formula C19H28IN5O2S2 and a molecular weight of 549.50 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111932670 |
| Molecular Formula | C19H28IN5O2S2 |
| Molecular Weight | 549.50 g/mol |
| Exact Mass | 549.07 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-ethyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)N1CCc2ccccc21)NCCc1csc(C)n1.I |
| InChI | InChI=1S/C19H27N5O2S2.HI/c1-3-20-19(21-10-8-17-14-27-15(2)23-17)22-11-13-28(25,26)24-12-9-16-6-4-5-7-18(16)24;/h4-7,14H,3,8-13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | IQNIHIGFFXCMRP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|