C15H22N4O2S — CID 110030617
1-cyclopropyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-methylguanidine (PubChem CID 110030617) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is 1-cyclopropyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-methylguanidine.
| Compound Name | 1-cyclopropyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-methylguanidine |
|---|---|
| PubChem CID | 110030617 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 1-cyclopropyl-2-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-1-methylguanidine |
| SMILES | CN(/C(N)=N/CCS(=O)(=O)N1CCc2ccccc21)C1CC1 |
| InChI | InChI=1S/C15H22N4O2S/c1-18(13-6-7-13)15(16)17-9-11-22(20,21)19-10-8-12-4-2-3-5-14(12)19/h2-5,13H,6-11H2,1H3,(H2,16,17) |
| InChIKey | MJPPIDZPULKERP-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|