C11H23IN4O2S2 — CID 110031118
1-cyclopropyl-1-methyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide (PubChem CID 110031118) has the molecular formula C11H23IN4O2S2 and a molecular weight of 434.37 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-1-methyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110031118 |
| Molecular Formula | C11H23IN4O2S2 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-(2-thiomorpholin-4-ylsulfonylethyl)guanidine;hydroiodide |
| SMILES | CN(/C(N)=N/CCS(=O)(=O)N1CCSCC1)C1CC1.I |
| InChI | InChI=1S/C11H22N4O2S2.HI/c1-14(10-2-3-10)11(12)13-4-9-19(16,17)15-5-7-18-8-6-15;/h10H,2-9H2,1H3,(H2,12,13);1H |
| InChIKey | GMUSQVZASVPBHI-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|