C10H21IN4O — CID 110030278
3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide (PubChem CID 110030278) has the molecular formula C10H21IN4O and a molecular weight of 340.21 g/mol. Its IUPAC name is 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110030278 |
| Molecular Formula | C10H21IN4O |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,N-dimethylpropanamide;hydroiodide |
| SMILES | CN(C)C(=O)CC/N=C(\N)N(C)C1CC1.I |
| InChI | InChI=1S/C10H20N4O.HI/c1-13(2)9(15)6-7-12-10(11)14(3)8-4-5-8;/h8H,4-7H2,1-3H3,(H2,11,12);1H |
| InChIKey | UBGUAVHWERNLEZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|