C11H23IN4O — CID 110031718
3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide (PubChem CID 110031718) has the molecular formula C11H23IN4O and a molecular weight of 354.24 g/mol. Its IUPAC name is 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide.
| Compound Name | 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 110031718 |
| Molecular Formula | C11H23IN4O |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 3-[[amino-[cyclopropyl(methyl)amino]methylidene]amino]-N,2,2-trimethylpropanamide;hydroiodide |
| SMILES | CNC(=O)C(C)(C)C/N=C(\N)N(C)C1CC1.I |
| InChI | InChI=1S/C11H22N4O.HI/c1-11(2,9(16)13-3)7-14-10(12)15(4)8-5-6-8;/h8H,5-7H2,1-4H3,(H2,12,14)(H,13,16);1H |
| InChIKey | UZMLHEUHCSZYLH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|