C5H13IN4 — CID 87258181
2-amino-1-cyclopropyl-1-methylguanidine;hydroiodide (PubChem CID 87258181) has the molecular formula C5H13IN4 and a molecular weight of 256.09 g/mol. Its IUPAC name is 2-amino-1-cyclopropyl-1-methylguanidine;hydroiodide.
| Compound Name | 2-amino-1-cyclopropyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 87258181 |
| Molecular Formula | C5H13IN4 |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-amino-1-cyclopropyl-1-methylguanidine;hydroiodide |
| SMILES | CN(/C(N)=N/N)C1CC1.I |
| InChI | InChI=1S/C5H12N4.HI/c1-9(4-2-3-4)5(6)8-7;/h4H,2-3,7H2,1H3,(H2,6,8);1H |
| InChIKey | JKTHRRISKYEYTC-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|