C9H21N5 — CID 77054011
2-amino-1-(1-ethylpiperidin-4-yl)-1-methylguanidine (PubChem CID 77054011) has the molecular formula C9H21N5 and a molecular weight of 199.30 g/mol. Its IUPAC name is 2-amino-1-(1-ethylpiperidin-4-yl)-1-methylguanidine.
| Compound Name | 2-amino-1-(1-ethylpiperidin-4-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 77054011 |
| Molecular Formula | C9H21N5 |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.18 |
| IUPAC Name | 2-amino-1-(1-ethylpiperidin-4-yl)-1-methylguanidine |
| SMILES | CCN1CCC(N(C)C(N)=NN)CC1 |
| InChI | InChI=1S/C9H21N5/c1-3-14-6-4-8(5-7-14)13(2)9(10)12-11/h8H,3-7,11H2,1-2H3,(H2,10,12) |
| InChIKey | OVOQLOSATAGOKP-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 70.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|