C13H28N4 — CID 62362142
2-tert-butyl-1-(1-ethylpiperidin-4-yl)-1-methylguanidine (PubChem CID 62362142) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-tert-butyl-1-(1-ethylpiperidin-4-yl)-1-methylguanidine.
| Compound Name | 2-tert-butyl-1-(1-ethylpiperidin-4-yl)-1-methylguanidine |
|---|---|
| PubChem CID | 62362142 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 2-tert-butyl-1-(1-ethylpiperidin-4-yl)-1-methylguanidine |
| SMILES | CCN1CCC(N(C)/C(N)=N/C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H28N4/c1-6-17-9-7-11(8-10-17)16(5)12(14)15-13(2,3)4/h11H,6-10H2,1-5H3,(H2,14,15) |
| InChIKey | QNMGLVPQDSTKGJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|