C21H37N5O2S — CID 110998093
1-[5-(diethylamino)pentan-2-yl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine (PubChem CID 110998093) has the molecular formula C21H37N5O2S and a molecular weight of 423.63 g/mol. Its IUPAC name is 1-[5-(diethylamino)pentan-2-yl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine.
| Compound Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110998093 |
| Molecular Formula | C21H37N5O2S |
| Molecular Weight | 423.63 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 1-[5-(diethylamino)pentan-2-yl]-3-[2-(2,3-dihydroindol-1-ylsulfonyl)ethyl]-2-methylguanidine |
| SMILES | CCN(CC)CCCC(C)N/C(=N\C)NCCS(=O)(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C21H37N5O2S/c1-5-25(6-2)15-9-10-18(3)24-21(22-4)23-14-17-29(27,28)26-16-13-19-11-7-8-12-20(19)26/h7-8,11-12,18H,5-6,9-10,13-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | NJTJAEDYPOZEGG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.63 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|