C16H30N4O4S — CID 111255259
methyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 111255259) has the molecular formula C16H30N4O4S and a molecular weight of 374.51 g/mol. Its IUPAC name is methyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 111255259 |
| Molecular Formula | C16H30N4O4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 1-[N'-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-N-ethylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C16H30N4O4S/c1-3-17-16(20-7-4-14(5-8-20)15(21)24-2)18-6-9-19-10-12-25(22,23)13-11-19/h14H,3-13H2,1-2H3,(H,17,18) |
| InChIKey | OPNPZHAVUAZDHR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|