C21H39N5O4 — CID 111253753
tert-butyl 4-[2-[[ethylamino-(4-methoxycarbonylpiperidin-1-yl)methylidene]amino]ethyl]piperazine-1-carboxylate (PubChem CID 111253753) has the molecular formula C21H39N5O4 and a molecular weight of 425.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[[ethylamino-(4-methoxycarbonylpiperidin-1-yl)methylidene]amino]ethyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[[ethylamino-(4-methoxycarbonylpiperidin-1-yl)methylidene]amino]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111253753 |
| Molecular Formula | C21H39N5O4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | tert-butyl 4-[2-[[ethylamino-(4-methoxycarbonylpiperidin-1-yl)methylidene]amino]ethyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCN1CCN(C(=O)OC(C)(C)C)CC1)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C21H39N5O4/c1-6-22-19(25-10-7-17(8-11-25)18(27)29-5)23-9-12-24-13-15-26(16-14-24)20(28)30-21(2,3)4/h17H,6-16H2,1-5H3,(H,22,23) |
| InChIKey | JXYQMKFSDVJSKL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|