C20H26IN5O2 — CID 111722692
N'-methyl-N-[2-(4-nitroanilino)ethyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide (PubChem CID 111722692) has the molecular formula C20H26IN5O2 and a molecular weight of 495.37 g/mol. Its IUPAC name is N'-methyl-N-[2-(4-nitroanilino)ethyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-[2-(4-nitroanilino)ethyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111722692 |
| Molecular Formula | C20H26IN5O2 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N'-methyl-N-[2-(4-nitroanilino)ethyl]-3-phenylpyrrolidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCCNc1ccc([N+](=O)[O-])cc1)N1CCC(c2ccccc2)C1.I |
| InChI | InChI=1S/C20H25N5O2.HI/c1-21-20(24-14-11-17(15-24)16-5-3-2-4-6-16)23-13-12-22-18-7-9-19(10-8-18)25(26)27;/h2-10,17,22H,11-15H2,1H3,(H,21,23);1H |
| InChIKey | ZQERMPZJODFDQU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|