C18H29FN4O2S — CID 111210959
N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-4-methylpiperidine-1-carboximidamide (PubChem CID 111210959) has the molecular formula C18H29FN4O2S and a molecular weight of 384.52 g/mol. Its IUPAC name is N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-4-methylpiperidine-1-carboximidamide.
| Compound Name | N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-4-methylpiperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111210959 |
| Molecular Formula | C18H29FN4O2S |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-ethyl-N'-[2-[(3-fluoro-4-methylphenyl)sulfamoyl]ethyl]-4-methylpiperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)Nc1ccc(C)c(F)c1)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H29FN4O2S/c1-4-20-18(23-10-7-14(2)8-11-23)21-9-12-26(24,25)22-16-6-5-15(3)17(19)13-16/h5-6,13-14,22H,4,7-12H2,1-3H3,(H,20,21) |
| InChIKey | BLFQSYVWQPAYMR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|