C19H36IN5O2 — CID 111162869
ethyl 4-[N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111162869) has the molecular formula C19H36IN5O2 and a molecular weight of 493.43 g/mol. Its IUPAC name is ethyl 4-[N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111162869 |
| Molecular Formula | C19H36IN5O2 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | ethyl 4-[N'-[2-[cyclopropyl(cyclopropylmethyl)amino]ethyl]-N-ethylcarbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCN(CC1CC1)C1CC1)N1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C19H35N5O2.HI/c1-3-20-18(22-11-13-23(14-12-22)19(25)26-4-2)21-9-10-24(17-7-8-17)15-16-5-6-16;/h16-17H,3-15H2,1-2H3,(H,20,21);1H |
| InChIKey | LRFAJSPIGXTPGX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|