C18H35N5O4 — CID 111163739
ethyl 4-[N-ethyl-N'-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamimidoyl]piperazine-1-carboxylate (PubChem CID 111163739) has the molecular formula C18H35N5O4 and a molecular weight of 385.51 g/mol. Its IUPAC name is ethyl 4-[N-ethyl-N'-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamimidoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[N-ethyl-N'-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 111163739 |
| Molecular Formula | C18H35N5O4 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | ethyl 4-[N-ethyl-N'-[2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]ethyl]carbamimidoyl]piperazine-1-carboxylate |
| SMILES | CCN/C(=N\CCN(C)C(=O)OC(C)(C)C)N1CCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C18H35N5O4/c1-7-19-15(20-9-10-21(6)16(24)27-18(3,4)5)22-11-13-23(14-12-22)17(25)26-8-2/h7-14H2,1-6H3,(H,19,20) |
| InChIKey | GDMNANDRQGFLPL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|