C14H29N3 — CID 111154559
N-ethyl-3,5-dimethyl-N'-(2-methylpropyl)piperidine-1-carboximidamide (PubChem CID 111154559) has the molecular formula C14H29N3 and a molecular weight of 239.41 g/mol. Its IUPAC name is N-ethyl-3,5-dimethyl-N'-(2-methylpropyl)piperidine-1-carboximidamide.
| Compound Name | N-ethyl-3,5-dimethyl-N'-(2-methylpropyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111154559 |
| Molecular Formula | C14H29N3 |
| Molecular Weight | 239.41 g/mol |
| Exact Mass | 239.24 |
| IUPAC Name | N-ethyl-3,5-dimethyl-N'-(2-methylpropyl)piperidine-1-carboximidamide |
| SMILES | CCN/C(=N\CC(C)C)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C14H29N3/c1-6-15-14(16-8-11(2)3)17-9-12(4)7-13(5)10-17/h11-13H,6-10H2,1-5H3,(H,15,16) |
| InChIKey | IBEYLBNQDMJBAV-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|