C15H29N3O2 — CID 111153272
methyl 3-[[(3,5-dimethylpiperidin-1-yl)-(ethylamino)methylidene]amino]-2-methylpropanoate (PubChem CID 111153272) has the molecular formula C15H29N3O2 and a molecular weight of 283.42 g/mol. Its IUPAC name is methyl 3-[[(3,5-dimethylpiperidin-1-yl)-(ethylamino)methylidene]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[(3,5-dimethylpiperidin-1-yl)-(ethylamino)methylidene]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 111153272 |
| Molecular Formula | C15H29N3O2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | methyl 3-[[(3,5-dimethylpiperidin-1-yl)-(ethylamino)methylidene]amino]-2-methylpropanoate |
| SMILES | CCN/C(=N\CC(C)C(=O)OC)N1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H29N3O2/c1-6-16-15(17-8-13(4)14(19)20-5)18-9-11(2)7-12(3)10-18/h11-13H,6-10H2,1-5H3,(H,16,17) |
| InChIKey | CNTHOLUABQZWLP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|