C17H30N4O3S — CID 119132430
N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-methylpropanoyl)-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 119132430) has the molecular formula C17H30N4O3S and a molecular weight of 370.52 g/mol. Its IUPAC name is N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-methylpropanoyl)-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-methylpropanoyl)-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 119132430 |
| Molecular Formula | C17H30N4O3S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | N'-[(1,1-dioxothiolan-3-yl)methyl]-4-(2-methylpropanoyl)-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\CC1CCS(=O)(=O)C1)N1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C17H30N4O3S/c1-4-6-18-17(19-12-15-5-11-25(23,24)13-15)21-9-7-20(8-10-21)16(22)14(2)3/h4,14-15H,1,5-13H2,2-3H3,(H,18,19) |
| InChIKey | UXLUJOKWSBEZAI-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|