C16H29N3O4S — CID 119139929
methyl 1-[N'-[(1,1-dioxothiolan-3-yl)methyl]-N-propan-2-ylcarbamimidoyl]piperidine-4-carboxylate (PubChem CID 119139929) has the molecular formula C16H29N3O4S and a molecular weight of 359.49 g/mol. Its IUPAC name is methyl 1-[N'-[(1,1-dioxothiolan-3-yl)methyl]-N-propan-2-ylcarbamimidoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[N'-[(1,1-dioxothiolan-3-yl)methyl]-N-propan-2-ylcarbamimidoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 119139929 |
| Molecular Formula | C16H29N3O4S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | methyl 1-[N'-[(1,1-dioxothiolan-3-yl)methyl]-N-propan-2-ylcarbamimidoyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(/C(=N/CC2CCS(=O)(=O)C2)NC(C)C)CC1 |
| InChI | InChI=1S/C16H29N3O4S/c1-12(2)18-16(17-10-13-6-9-24(21,22)11-13)19-7-4-14(5-8-19)15(20)23-3/h12-14H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | ZNLVDVJWLAAKCL-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|